C15H21N2O+ — CID 8909754
[2-(cyclopropylamino)-2-oxoethyl]-methyl-[(E)-3-phenylprop-2-enyl]azanium (PubChem CID 8909754) has the molecular formula C15H21N2O+ and a molecular weight of 245.35 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl]-methyl-[(E)-3-phenylprop-2-enyl]azanium.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl]-methyl-[(E)-3-phenylprop-2-enyl]azanium |
|---|---|
| PubChem CID | 8909754 |
| Molecular Formula | C15H21N2O+ |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl]-methyl-[(E)-3-phenylprop-2-enyl]azanium |
| SMILES | C[NH+](C/C=C/c1ccccc1)CC(=O)NC1CC1 |
| InChI | InChI=1S/C15H20N2O/c1-17(12-15(18)16-14-9-10-14)11-5-8-13-6-3-2-4-7-13/h2-8,14H,9-12H2,1H3,(H,16,18)/p+1/b8-5+ |
| InChIKey | BIJINDFACWKDGO-VMPITWQZSA-O |
| XLogP | 0.49 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |