C17H26N3O2S+ — CID 8910747
[2-(2-benzylsulfanylethylamino)-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium (PubChem CID 8910747) has the molecular formula C17H26N3O2S+ and a molecular weight of 336.48 g/mol. Its IUPAC name is [2-(2-benzylsulfanylethylamino)-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8910747 |
| Molecular Formula | C17H26N3O2S+ |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [2-(2-benzylsulfanylethylamino)-2-oxoethyl]-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NCCSCc1ccccc1)CC(=O)NC1CC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-20(12-17(22)19-15-7-8-15)11-16(21)18-9-10-23-13-14-5-3-2-4-6-14/h2-6,15H,7-13H2,1H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | LDILIDGUVLFKIV-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|