C18H26N2O3S — CID 8754615
methyl 1-[2-(2-benzylsulfanylethylamino)-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 8754615) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl 1-[2-(2-benzylsulfanylethylamino)-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(2-benzylsulfanylethylamino)-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8754615 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | methyl 1-[2-(2-benzylsulfanylethylamino)-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(CC(=O)NCCSCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O3S/c1-23-18(22)16-7-10-20(11-8-16)13-17(21)19-9-12-24-14-15-5-3-2-4-6-15/h2-6,16H,7-14H2,1H3,(H,19,21) |
| InChIKey | GUWQTRKQBOACNC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|