C19H29N3O2 — CID 27107050
N-benzyl-1-[2-(butylamino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 27107050) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-benzyl-1-[2-(butylamino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-(butylamino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27107050 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-benzyl-1-[2-(butylamino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)CN1CCC(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-2-3-11-20-18(23)15-22-12-9-17(10-13-22)19(24)21-14-16-7-5-4-6-8-16/h4-8,17H,2-3,9-15H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | RODXGKAGDCPYQA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|