C19H29N3OS — CID 43076523
1-(benzylcarbamothioyl)-N-pentylpiperidine-4-carboxamide (PubChem CID 43076523) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-(benzylcarbamothioyl)-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-(benzylcarbamothioyl)-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 43076523 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(benzylcarbamothioyl)-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=S)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29N3OS/c1-2-3-7-12-20-18(23)17-10-13-22(14-11-17)19(24)21-15-16-8-5-4-6-9-16/h4-6,8-9,17H,2-3,7,10-15H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | ADWIQCNYMUPKFT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|