C18H27N3O5 — CID 119355875
1-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 119355875) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119355875 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)N1CCCC1C(=O)O)C2=O |
| InChI | InChI=1S/C18H27N3O5/c1-11-7-17(2,3)10-18(8-11)15(25)21(16(26)19-18)9-13(22)20-6-4-5-12(20)14(23)24/h11-12H,4-10H2,1-3H3,(H,19,26)(H,23,24) |
| InChIKey | KUGSPCDQEVELTN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|