C20H31N3O5S — CID 98690657
ethyl (3R)-4-[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]thiomorpholine-3-carboxylate (PubChem CID 98690657) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is ethyl (3R)-4-[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]thiomorpholine-3-carboxylate.
| Compound Name | ethyl (3R)-4-[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 98690657 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethyl (3R)-4-[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]thiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSCCN1C(=O)CN1C(=O)N[C@]2(C[C@@H](C)CC(C)(C)C2)C1=O |
| InChI | InChI=1S/C20H31N3O5S/c1-5-28-16(25)14-11-29-7-6-22(14)15(24)10-23-17(26)20(21-18(23)27)9-13(2)8-19(3,4)12-20/h13-14H,5-12H2,1-4H3,(H,21,27)/t13-,14-,20-/m0/s1 |
| InChIKey | CHCVUBWZGSGKIK-YRVVQQKDSA-N |
| XLogP | 1.63 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|