C24H33N3O4 — CID 46532817
3-[2-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 46532817) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[2-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 46532817 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[2-[2-(3-methoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cccc(C2CCCN2C(=O)CN2C(=O)NC3(CC(C)CC(C)(C)C3)C2=O)c1 |
| InChI | InChI=1S/C24H33N3O4/c1-16-12-23(2,3)15-24(13-16)21(29)27(22(30)25-24)14-20(28)26-10-6-9-19(26)17-7-5-8-18(11-17)31-4/h5,7-8,11,16,19H,6,9-10,12-15H2,1-4H3,(H,25,30) |
| InChIKey | IWBKNABXSOKCCV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|