C16H26N2O4 — CID 7910416
(5S,9S)-3-[[(4S)-1,3-dioxan-4-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7910416) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is (5S,9S)-3-[[(4S)-1,3-dioxan-4-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,9S)-3-[[(4S)-1,3-dioxan-4-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7910416 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (5S,9S)-3-[[(4S)-1,3-dioxan-4-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(C[C@@H]1CCOCO1)C2=O |
| InChI | InChI=1S/C16H26N2O4/c1-11-6-15(2,3)9-16(7-11)13(19)18(14(20)17-16)8-12-4-5-21-10-22-12/h11-12H,4-10H2,1-3H3,(H,17,20)/t11-,12-,16-/m0/s1 |
| InChIKey | LOOCYXDYPUNITO-MKBNYLNASA-N |
| XLogP | 1.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|