C18H27N5O3 — CID 112787596
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 112787596) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 112787596 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)CN1C(=O)NC2(CC(C)CC(C)(C)C2)C1=O |
| InChI | InChI=1S/C18H27N5O3/c1-10-6-17(4,5)9-18(7-10)15(25)23(16(26)20-18)8-13(24)19-14-11(2)21-22-12(14)3/h10H,6-9H2,1-5H3,(H,19,24)(H,20,26)(H,21,22) |
| InChIKey | LWUWXZZBNAOXMW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|