C23H31N7O3 — CID 55354811
N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55354811) has the molecular formula C23H31N7O3 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55354811 |
| Molecular Formula | C23H31N7O3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | Cc1cc(C)nc(-n2nc(C)cc2NC(=O)CN2C(=O)NC3(CC(C)CC(C)(C)C3)C2=O)n1 |
| InChI | InChI=1S/C23H31N7O3/c1-13-9-22(5,6)12-23(10-13)19(32)29(21(33)27-23)11-18(31)26-17-8-16(4)28-30(17)20-24-14(2)7-15(3)25-20/h7-8,13H,9-12H2,1-6H3,(H,26,31)(H,27,33) |
| InChIKey | VOHIKLZHPPHXPG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|