C23H33N5O4 — CID 13304622
[1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate (PubChem CID 13304622) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is [1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate.
| Compound Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 13304622 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(CN1CCN(c2ncccn2)CC1)CN1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C23H33N5O4/c1-16(2)22(31)32-17(15-28-20(29)18-6-3-4-7-19(18)21(28)30)14-26-10-12-27(13-11-26)23-24-8-5-9-25-23/h5,8-9,16-19H,3-4,6-7,10-15H2,1-2H3/t17?,18-,19+ |
| InChIKey | GLCRZSAYMPCSFU-YQQQUEKLSA-N |
| XLogP | 1.34 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|