C23H30ClN3O4 — CID 13304595
[1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-yl] acetate (PubChem CID 13304595) has the molecular formula C23H30ClN3O4 and a molecular weight of 447.96 g/mol. Its IUPAC name is [1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-yl] acetate.
| Compound Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-yl] acetate |
|---|---|
| PubChem CID | 13304595 |
| Molecular Formula | C23H30ClN3O4 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-2-yl] acetate |
| SMILES | CC(=O)OC(CN1CCN(c2cccc(Cl)c2)CC1)CN1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C23H30ClN3O4/c1-16(28)31-19(15-27-22(29)20-7-2-3-8-21(20)23(27)30)14-25-9-11-26(12-10-25)18-6-4-5-17(24)13-18/h4-6,13,19-21H,2-3,7-12,14-15H2,1H3/t19?,20-,21+ |
| InChIKey | DZYDSGZTIRWKGS-SEJPIABJSA-N |
| XLogP | 2.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|