C31H32ClN3O8 — CID 22828279
[1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propan-2-yl] benzoate;oxalic acid (PubChem CID 22828279) has the molecular formula C31H32ClN3O8 and a molecular weight of 610.06 g/mol. Its IUPAC name is [1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propan-2-yl] benzoate;oxalic acid.
| Compound Name | [1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propan-2-yl] benzoate;oxalic acid |
|---|---|
| PubChem CID | 22828279 |
| Molecular Formula | C31H32ClN3O8 |
| Molecular Weight | 610.06 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | [1-[4-(3-chlorophenyl)piperazin-1-yl]-3-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propan-2-yl] benzoate;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(OC(CN1CCN(c2cccc(Cl)c2)CC1)CN1C(=O)C2C3C=C[C@@H](C3)[C@@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C29H30ClN3O4.C2H2O4/c30-22-7-4-8-23(16-22)32-13-11-31(12-14-32)17-24(37-29(36)19-5-2-1-3-6-19)18-33-27(34)25-20-9-10-21(15-20)26(25)28(33)35;3-1(4)2(5)6/h1-10,16,20-21,24-26H,11-15,17-18H2;(H,3,4)(H,5,6)/t20-,21?,24?,25-,26?;/m0./s1 |
| InChIKey | GEFCYYXSMZWMGZ-CMWLMBKPSA-N |
| XLogP | 2.65 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|