C32H41N5O8 — CID 70515152
(Z)-but-2-enedioic acid;[1-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] N-cyclohexylcarbamate (PubChem CID 70515152) has the molecular formula C32H41N5O8 and a molecular weight of 623.71 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[1-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] N-cyclohexylcarbamate.
| Compound Name | (Z)-but-2-enedioic acid;[1-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 70515152 |
| Molecular Formula | C32H41N5O8 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | (Z)-but-2-enedioic acid;[1-[(6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)C2C3C=C[C@@H](C3)[C@@H]2C1=O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C28H37N5O4.C4H4O4/c34-26-24-19-9-10-20(16-19)25(24)27(35)33(26)18-22(37-28(36)30-21-6-2-1-3-7-21)17-31-12-14-32(15-13-31)23-8-4-5-11-29-23;5-3(6)1-2-4(7)8/h4-5,8-11,19-22,24-25H,1-3,6-7,12-18H2,(H,30,36);1-2H,(H,5,6)(H,7,8)/b;2-1-/t19-,20?,22?,24-,25?;/m0./s1 |
| InChIKey | HWPNVYJCHGMDNT-MCTBQAKASA-N |
| XLogP | 2.15 |
| TPSA | 169.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|