C30H40N4O4 — CID 13342960
[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] (E)-non-2-enoate (PubChem CID 13342960) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is [1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] (E)-non-2-enoate.
| Compound Name | [1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] (E)-non-2-enoate |
|---|---|
| PubChem CID | 13342960 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | [1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] (E)-non-2-enoate |
| SMILES | CCCCCC/C=C/C(=O)OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C30H40N4O4/c1-2-3-4-5-6-7-11-26(35)38-24(20-32-15-17-33(18-16-32)25-10-8-9-14-31-25)21-34-29(36)27-22-12-13-23(19-22)28(27)30(34)37/h7-14,22-24,27-28H,2-6,15-21H2,1H3/b11-7+ |
| InChIKey | GXCMCJHBITVXNU-YRNVUSSQSA-N |
| XLogP | 3.45 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|