C33H40N4O8 — CID 70514159
but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] non-2-enoate (PubChem CID 70514159) has the molecular formula C33H40N4O8 and a molecular weight of 620.70 g/mol. Its IUPAC name is but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] non-2-enoate.
| Compound Name | but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] non-2-enoate |
|---|---|
| PubChem CID | 70514159 |
| Molecular Formula | C33H40N4O8 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] non-2-enoate |
| SMILES | CCCCCCC=CC(=O)OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)c2ccccc2C1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C29H36N4O4.C4H4O4/c1-2-3-4-5-6-7-15-27(34)37-23(22-33-28(35)24-12-8-9-13-25(24)29(33)36)21-31-17-19-32(20-18-31)26-14-10-11-16-30-26;5-3(6)1-2-4(7)8/h7-16,23H,2-6,17-22H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | PYFQJZVIRLTOJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 157.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|