C30H31N5O7 — CID 70514091
but-2-enedioic acid;2-[2-(pyridin-3-ylmethoxy)-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione (PubChem CID 70514091) has the molecular formula C30H31N5O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is but-2-enedioic acid;2-[2-(pyridin-3-ylmethoxy)-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione.
| Compound Name | but-2-enedioic acid;2-[2-(pyridin-3-ylmethoxy)-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70514091 |
| Molecular Formula | C30H31N5O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | but-2-enedioic acid;2-[2-(pyridin-3-ylmethoxy)-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C(O)C=CC(=O)O.O=C1c2ccccc2C(=O)N1CC(CN1CCN(c2ccccn2)CC1)OCc1cccnc1 |
| InChI | InChI=1S/C26H27N5O3.C4H4O4/c32-25-22-7-1-2-8-23(22)26(33)31(25)18-21(34-19-20-6-5-10-27-16-20)17-29-12-14-30(15-13-29)24-9-3-4-11-28-24;5-3(6)1-2-4(7)8/h1-11,16,21H,12-15,17-19H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | LLQUDIBDZCHSSA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|