C21H26N4O3 — CID 52901755
(2R)-4-(benzylamino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid (PubChem CID 52901755) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R)-4-(benzylamino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid.
| Compound Name | (2R)-4-(benzylamino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 52901755 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2R)-4-(benzylamino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid |
| SMILES | O=C(C[C@H](CN1CCN(c2ccccn2)CC1)C(=O)O)NCc1ccccc1 |
| InChI | InChI=1S/C21H26N4O3/c26-20(23-15-17-6-2-1-3-7-17)14-18(21(27)28)16-24-10-12-25(13-11-24)19-8-4-5-9-22-19/h1-9,18H,10-16H2,(H,23,26)(H,27,28)/t18-/m1/s1 |
| InChIKey | CKKHALXATJZLDE-GOSISDBHSA-N |
| XLogP | 1.61 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |