C20H23FN4O3 — CID 95390459
(2R)-4-(2-fluoroanilino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid (PubChem CID 95390459) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is (2R)-4-(2-fluoroanilino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid.
| Compound Name | (2R)-4-(2-fluoroanilino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 95390459 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (2R)-4-(2-fluoroanilino)-4-oxo-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]butanoic acid |
| SMILES | O=C(C[C@H](CN1CCN(c2ccccn2)CC1)C(=O)O)Nc1ccccc1F |
| InChI | InChI=1S/C20H23FN4O3/c21-16-5-1-2-6-17(16)23-19(26)13-15(20(27)28)14-24-9-11-25(12-10-24)18-7-3-4-8-22-18/h1-8,15H,9-14H2,(H,23,26)(H,27,28)/t15-/m1/s1 |
| InChIKey | HSSYDGYFRBCVAT-OAHLLOKOSA-N |
| XLogP | 2.07 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |