C21H25ClN4O3 — CID 53369388
4-(4-chloroanilino)-4-oxo-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]butanoic acid (PubChem CID 53369388) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-(4-chloroanilino)-4-oxo-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]butanoic acid.
| Compound Name | 4-(4-chloroanilino)-4-oxo-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 53369388 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-(4-chloroanilino)-4-oxo-2-[[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]butanoic acid |
| SMILES | O=C(CC(CN1CCN(Cc2ccccn2)CC1)C(=O)O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN4O3/c22-17-4-6-18(7-5-17)24-20(27)13-16(21(28)29)14-25-9-11-26(12-10-25)15-19-3-1-2-8-23-19/h1-8,16H,9-15H2,(H,24,27)(H,28,29) |
| InChIKey | NOMYWYJENUGTQQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |