C17H22ClN3O4 — CID 95389358
(2R)-2-[(4-acetylpiperazin-1-yl)methyl]-4-(4-chloroanilino)-4-oxobutanoic acid (PubChem CID 95389358) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is (2R)-2-[(4-acetylpiperazin-1-yl)methyl]-4-(4-chloroanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(4-acetylpiperazin-1-yl)methyl]-4-(4-chloroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 95389358 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (2R)-2-[(4-acetylpiperazin-1-yl)methyl]-4-(4-chloroanilino)-4-oxobutanoic acid |
| SMILES | CC(=O)N1CCN(C[C@@H](CC(=O)Nc2ccc(Cl)cc2)C(=O)O)CC1 |
| InChI | InChI=1S/C17H22ClN3O4/c1-12(22)21-8-6-20(7-9-21)11-13(17(24)25)10-16(23)19-15-4-2-14(18)3-5-15/h2-5,13H,6-11H2,1H3,(H,19,23)(H,24,25)/t13-/m1/s1 |
| InChIKey | HKYYQZBGXYSXGP-CYBMUJFWSA-N |
| XLogP | 1.53 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |