C14H18ClN3O3 — CID 95859297
(2R)-4-[(6-chloro-3-pyridinyl)amino]-4-oxo-2-(pyrrolidin-1-ylmethyl)butanoic acid (PubChem CID 95859297) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is (2R)-4-[(6-chloro-3-pyridinyl)amino]-4-oxo-2-(pyrrolidin-1-ylmethyl)butanoic acid.
| Compound Name | (2R)-4-[(6-chloro-3-pyridinyl)amino]-4-oxo-2-(pyrrolidin-1-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 95859297 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (2R)-4-[(6-chloro-3-pyridinyl)amino]-4-oxo-2-(pyrrolidin-1-ylmethyl)butanoic acid |
| SMILES | O=C(C[C@H](CN1CCCC1)C(=O)O)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H18ClN3O3/c15-12-4-3-11(8-16-12)17-13(19)7-10(14(20)21)9-18-5-1-2-6-18/h3-4,8,10H,1-2,5-7,9H2,(H,17,19)(H,20,21)/t10-/m1/s1 |
| InChIKey | UWFUGUXWWOAZPO-SNVBAGLBSA-N |
| XLogP | 1.86 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|