C16H19F3N4O4 — CID 95860398
(2R)-2-[(4-formylpiperazin-1-yl)methyl]-4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoic acid (PubChem CID 95860398) has the molecular formula C16H19F3N4O4 and a molecular weight of 388.35 g/mol. Its IUPAC name is (2R)-2-[(4-formylpiperazin-1-yl)methyl]-4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoic acid.
| Compound Name | (2R)-2-[(4-formylpiperazin-1-yl)methyl]-4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoic acid |
|---|---|
| PubChem CID | 95860398 |
| Molecular Formula | C16H19F3N4O4 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2R)-2-[(4-formylpiperazin-1-yl)methyl]-4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoic acid |
| SMILES | O=CN1CCN(C[C@@H](CC(=O)Nc2ccc(C(F)(F)F)nc2)C(=O)O)CC1 |
| InChI | InChI=1S/C16H19F3N4O4/c17-16(18,19)13-2-1-12(8-20-13)21-14(25)7-11(15(26)27)9-22-3-5-23(10-24)6-4-22/h1-2,8,10-11H,3-7,9H2,(H,21,25)(H,26,27)/t11-/m1/s1 |
| InChIKey | LMKIRRBOBSLRAF-LLVKDONJSA-N |
| XLogP | 0.90 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|