C10H10ClF3N2O — CID 82810971
4-chloro-N-[6-(trifluoromethyl)-3-pyridinyl]butanamide (PubChem CID 82810971) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 4-chloro-N-[6-(trifluoromethyl)-3-pyridinyl]butanamide.
| Compound Name | 4-chloro-N-[6-(trifluoromethyl)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 82810971 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-chloro-N-[6-(trifluoromethyl)-3-pyridinyl]butanamide |
| SMILES | O=C(CCCCl)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10ClF3N2O/c11-5-1-2-9(17)16-7-3-4-8(15-6-7)10(12,13)14/h3-4,6H,1-2,5H2,(H,16,17) |
| InChIKey | PXZRXICDCAHIES-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|