C12H13F3N2O3 — CID 82706361
ethyl 4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoate (PubChem CID 82706361) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is ethyl 4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoate.
| Compound Name | ethyl 4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoate |
|---|---|
| PubChem CID | 82706361 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | ethyl 4-oxo-4-[[6-(trifluoromethyl)-3-pyridinyl]amino]butanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-2-20-11(19)6-5-10(18)17-8-3-4-9(16-7-8)12(13,14)15/h3-4,7H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | IJGOWWOYBULAOC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |