C21H18F3N3O — CID 138674390
N-pyridin-3-yl-4-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]butanamide (PubChem CID 138674390) has the molecular formula C21H18F3N3O and a molecular weight of 385.39 g/mol. Its IUPAC name is N-pyridin-3-yl-4-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]butanamide.
| Compound Name | N-pyridin-3-yl-4-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]butanamide |
|---|---|
| PubChem CID | 138674390 |
| Molecular Formula | C21H18F3N3O |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-pyridin-3-yl-4-[4-[6-(trifluoromethyl)-3-pyridinyl]phenyl]butanamide |
| SMILES | O=C(CCCc1ccc(-c2ccc(C(F)(F)F)nc2)cc1)Nc1cccnc1 |
| InChI | InChI=1S/C21H18F3N3O/c22-21(23,24)19-11-10-17(13-26-19)16-8-6-15(7-9-16)3-1-5-20(28)27-18-4-2-12-25-14-18/h2,4,6-14H,1,3,5H2,(H,27,28) |
| InChIKey | GOSAEJKZRDIKCF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |