C25H23N3O — CID 138674422
4-[4-(2-methylquinolin-6-yl)phenyl]-N-pyridin-3-ylbutanamide (PubChem CID 138674422) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[4-(2-methylquinolin-6-yl)phenyl]-N-pyridin-3-ylbutanamide.
| Compound Name | 4-[4-(2-methylquinolin-6-yl)phenyl]-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 138674422 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[4-(2-methylquinolin-6-yl)phenyl]-N-pyridin-3-ylbutanamide |
| SMILES | Cc1ccc2cc(-c3ccc(CCCC(=O)Nc4cccnc4)cc3)ccc2n1 |
| InChI | InChI=1S/C25H23N3O/c1-18-7-10-22-16-21(13-14-24(22)27-18)20-11-8-19(9-12-20)4-2-6-25(29)28-23-5-3-15-26-17-23/h3,5,7-17H,2,4,6H2,1H3,(H,28,29) |
| InChIKey | QQUBHHYRBMLKCY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |