C22H19N3O2 — CID 138674485
4-[4-(1,3-benzoxazol-5-yl)phenyl]-N-pyridin-3-ylbutanamide (PubChem CID 138674485) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[4-(1,3-benzoxazol-5-yl)phenyl]-N-pyridin-3-ylbutanamide.
| Compound Name | 4-[4-(1,3-benzoxazol-5-yl)phenyl]-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 138674485 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[4-(1,3-benzoxazol-5-yl)phenyl]-N-pyridin-3-ylbutanamide |
| SMILES | O=C(CCCc1ccc(-c2ccc3ocnc3c2)cc1)Nc1cccnc1 |
| InChI | InChI=1S/C22H19N3O2/c26-22(25-19-4-2-12-23-14-19)5-1-3-16-6-8-17(9-7-16)18-10-11-21-20(13-18)24-15-27-21/h2,4,6-15H,1,3,5H2,(H,25,26) |
| InChIKey | MVRWKQDMDUZZKD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |