C23H24N4O — CID 164706505
4-[4-(4-amino-3-methanimidoyl-2-methylphenyl)phenyl]-N-pyridin-3-ylbutanamide (PubChem CID 164706505) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[4-(4-amino-3-methanimidoyl-2-methylphenyl)phenyl]-N-pyridin-3-ylbutanamide.
| Compound Name | 4-[4-(4-amino-3-methanimidoyl-2-methylphenyl)phenyl]-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 164706505 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[4-(4-amino-3-methanimidoyl-2-methylphenyl)phenyl]-N-pyridin-3-ylbutanamide |
| SMILES | [H]/N=C/c1c(N)ccc(-c2ccc(CCCC(=O)Nc3cccnc3)cc2)c1C |
| InChI | InChI=1S/C23H24N4O/c1-16-20(11-12-22(25)21(16)14-24)18-9-7-17(8-10-18)4-2-6-23(28)27-19-5-3-13-26-15-19/h3,5,7-15,24H,2,4,6,25H2,1H3,(H,27,28)/b24-14+ |
| InChIKey | VVAJPGWUMLXTKN-ZVHZXABRSA-N |
| XLogP | 4.60 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|