C14H17F3N4O2 — CID 56761469
3-(4-formylpiperazin-1-yl)-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 56761469) has the molecular formula C14H17F3N4O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 3-(4-formylpiperazin-1-yl)-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | 3-(4-formylpiperazin-1-yl)-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 56761469 |
| Molecular Formula | C14H17F3N4O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-(4-formylpiperazin-1-yl)-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | O=CN1CCN(CCC(=O)Nc2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C14H17F3N4O2/c15-14(16,17)12-2-1-11(9-18-12)19-13(23)3-4-20-5-7-21(10-22)8-6-20/h1-2,9-10H,3-8H2,(H,19,23) |
| InChIKey | QZAMEGOOQIBQIR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|