C19H25N5O3S — CID 162665066
3-(4-pyridin-2-ylpiperazin-1-yl)-N-[(4-sulfamoylphenyl)methyl]propanamide (PubChem CID 162665066) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is 3-(4-pyridin-2-ylpiperazin-1-yl)-N-[(4-sulfamoylphenyl)methyl]propanamide.
| Compound Name | 3-(4-pyridin-2-ylpiperazin-1-yl)-N-[(4-sulfamoylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 162665066 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-(4-pyridin-2-ylpiperazin-1-yl)-N-[(4-sulfamoylphenyl)methyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CCN2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C19H25N5O3S/c20-28(26,27)17-6-4-16(5-7-17)15-22-19(25)8-10-23-11-13-24(14-12-23)18-3-1-2-9-21-18/h1-7,9H,8,10-15H2,(H,22,25)(H2,20,26,27) |
| InChIKey | QJCIEVPMVOLTEN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |