C21H23N5O4 — CID 69199029
(Z)-but-2-enedioic acid;2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-benzimidazole (PubChem CID 69199029) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-benzimidazole.
| Compound Name | (Z)-but-2-enedioic acid;2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 69199029 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-1H-benzimidazole |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc(N2CCN(Cc3nc4ccccc4[nH]3)CC2)nc1 |
| InChI | InChI=1S/C17H19N5.C4H4O4/c1-2-6-15-14(5-1)19-16(20-15)13-21-9-11-22(12-10-21)17-7-3-4-8-18-17;5-3(6)1-2-4(7)8/h1-8H,9-13H2,(H,19,20);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SPGKIJTUZIVUIZ-BTJKTKAUSA-N |
| XLogP | 1.99 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|