C24H26N4O9 — CID 71780693
2-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]-1-phenylethanone;oxalic acid (PubChem CID 71780693) has the molecular formula C24H26N4O9 and a molecular weight of 514.49 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]-1-phenylethanone;oxalic acid.
| Compound Name | 2-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]-1-phenylethanone;oxalic acid |
|---|---|
| PubChem CID | 71780693 |
| Molecular Formula | C24H26N4O9 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]-1-phenylethanone;oxalic acid |
| SMILES | O=C(CN1CCN(Cc2nc3ccccc3[nH]2)CC1)c1ccccc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H22N4O.2C2H2O4/c25-19(16-6-2-1-3-7-16)14-23-10-12-24(13-11-23)15-20-21-17-8-4-5-9-18(17)22-20;2*3-1(4)2(5)6/h1-9H,10-15H2,(H,21,22);2*(H,3,4)(H,5,6) |
| InChIKey | VBPLHDFMUKKUSD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 201.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|