C23H24N6O5 — CID 71780611
2-(benzimidazol-1-yl)-1-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]ethanone;oxalic acid (PubChem CID 71780611) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-1-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]ethanone;oxalic acid.
| Compound Name | 2-(benzimidazol-1-yl)-1-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]ethanone;oxalic acid |
|---|---|
| PubChem CID | 71780611 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-(benzimidazol-1-yl)-1-[4-(1H-benzimidazol-2-ylmethyl)piperazin-1-yl]ethanone;oxalic acid |
| SMILES | O=C(Cn1cnc2ccccc21)N1CCN(Cc2nc3ccccc3[nH]2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H22N6O.C2H2O4/c28-21(14-27-15-22-18-7-3-4-8-19(18)27)26-11-9-25(10-12-26)13-20-23-16-5-1-2-6-17(16)24-20;3-1(4)2(5)6/h1-8,15H,9-14H2,(H,23,24);(H,3,4)(H,5,6) |
| InChIKey | LUXDWABTUJSCIH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|