C27H30N4O4 — CID 13304562
[1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] benzoate (PubChem CID 13304562) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is [1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] benzoate.
| Compound Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] benzoate |
|---|---|
| PubChem CID | 13304562 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] benzoate |
| SMILES | O=C(OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H30N4O4/c32-25-22-10-4-5-11-23(22)26(33)31(25)19-21(35-27(34)20-8-2-1-3-9-20)18-29-14-16-30(17-15-29)24-12-6-7-13-28-24/h1-9,12-13,21-23H,10-11,14-19H2/t21?,22-,23+ |
| InChIKey | JBLFZSBPNFOQOA-NOTZXAQLSA-N |
| XLogP | 2.38 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|