C27H38N4O4 — CID 22828265
[1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] heptanoate (PubChem CID 22828265) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is [1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] heptanoate.
| Compound Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] heptanoate |
|---|---|
| PubChem CID | 22828265 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [1-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C27H38N4O4/c1-2-3-4-5-13-25(32)35-21(20-31-26(33)22-10-6-7-11-23(22)27(31)34)19-29-15-17-30(18-16-29)24-12-8-9-14-28-24/h6-9,12,14,21-23H,2-5,10-11,13,15-20H2,1H3/t21?,22-,23+ |
| InChIKey | FIOZPWCTDQJPIT-NOTZXAQLSA-N |
| XLogP | 3.04 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|