C30H29N5O8 — CID 70514089
but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] pyridine-3-carboxylate (PubChem CID 70514089) has the molecular formula C30H29N5O8 and a molecular weight of 587.59 g/mol. Its IUPAC name is but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] pyridine-3-carboxylate.
| Compound Name | but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 70514089 |
| Molecular Formula | C30H29N5O8 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | but-2-enedioic acid;[1-(1,3-dioxoisoindol-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-yl] pyridine-3-carboxylate |
| SMILES | O=C(O)C=CC(=O)O.O=C(OC(CN1CCN(c2ccccn2)CC1)CN1C(=O)c2ccccc2C1=O)c1cccnc1 |
| InChI | InChI=1S/C26H25N5O4.C4H4O4/c32-24-21-7-1-2-8-22(21)25(33)31(24)18-20(35-26(34)19-6-5-10-27-16-19)17-29-12-14-30(15-13-29)23-9-3-4-11-28-23;5-3(6)1-2-4(7)8/h1-11,16,20H,12-15,17-18H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RISABEVKOCISGF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|