C21H24ClN3O3 — CID 87475056
[1-[(Z)-[chloro(pyridin-3-yl)methylidene]amino]oxy-3-piperidin-1-ylpropan-2-yl] benzoate (PubChem CID 87475056) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is [1-[(Z)-[chloro(pyridin-3-yl)methylidene]amino]oxy-3-piperidin-1-ylpropan-2-yl] benzoate.
| Compound Name | [1-[(Z)-[chloro(pyridin-3-yl)methylidene]amino]oxy-3-piperidin-1-ylpropan-2-yl] benzoate |
|---|---|
| PubChem CID | 87475056 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [1-[(Z)-[chloro(pyridin-3-yl)methylidene]amino]oxy-3-piperidin-1-ylpropan-2-yl] benzoate |
| SMILES | O=C(OC(CO/N=C(\Cl)c1cccnc1)CN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H24ClN3O3/c22-20(18-10-7-11-23-14-18)24-27-16-19(15-25-12-5-2-6-13-25)28-21(26)17-8-3-1-4-9-17/h1,3-4,7-11,14,19H,2,5-6,12-13,15-16H2/b24-20- |
| InChIKey | IKBBRKZDODTRJO-GFMRDNFCSA-N |
| XLogP | 3.71 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|