C18H24ClN3O6 — CID 87925320
but-2-enedioic acid;(3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride (PubChem CID 87925320) has the molecular formula C18H24ClN3O6 and a molecular weight of 413.86 g/mol. Its IUPAC name is but-2-enedioic acid;(3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride.
| Compound Name | but-2-enedioic acid;(3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride |
|---|---|
| PubChem CID | 87925320 |
| Molecular Formula | C18H24ClN3O6 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | but-2-enedioic acid;(3Z)-N-(2-hydroxy-3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride |
| SMILES | O=C(O)C=CC(=O)O.OC(CO/N=C(\Cl)c1cccnc1)CN1CCCCC1 |
| InChI | InChI=1S/C14H20ClN3O2.C4H4O4/c15-14(12-5-4-6-16-9-12)17-20-11-13(19)10-18-7-2-1-3-8-18;5-3(6)1-2-4(7)8/h4-6,9,13,19H,1-3,7-8,10-11H2;1-2H,(H,5,6)(H,7,8)/b17-14-; |
| InChIKey | RPNGOMBXNOMBCG-SBBUSYCLSA-N |
| XLogP | 1.56 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|