C14H22Cl3N3O3 — CID 87879749
N-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidoyl chloride;dihydrochloride (PubChem CID 87879749) has the molecular formula C14H22Cl3N3O3 and a molecular weight of 386.71 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidoyl chloride;dihydrochloride.
| Compound Name | N-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidoyl chloride;dihydrochloride |
|---|---|
| PubChem CID | 87879749 |
| Molecular Formula | C14H22Cl3N3O3 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-piperidin-1-ylpropoxy]-1-oxidopyridin-1-ium-3-carboximidoyl chloride;dihydrochloride |
| SMILES | Cl.Cl.[O-][n+]1cccc(C(Cl)=NOC[C@H](O)CN2CCCCC2)c1 |
| InChI | InChI=1S/C14H20ClN3O3.2ClH/c15-14(12-5-4-8-18(20)9-12)16-21-11-13(19)10-17-6-2-1-3-7-17;;/h4-5,8-9,13,19H,1-3,6-7,10-11H2;2*1H/t13-;;/m1../s1 |
| InChIKey | QEYIVDYLGBSLLB-FFXKMJQXSA-N |
| XLogP | 1.93 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|