C14H22Cl3N3O — CID 73462266
N-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride;dihydrochloride (PubChem CID 73462266) has the molecular formula C14H22Cl3N3O and a molecular weight of 354.71 g/mol. Its IUPAC name is N-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride;dihydrochloride.
| Compound Name | N-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride;dihydrochloride |
|---|---|
| PubChem CID | 73462266 |
| Molecular Formula | C14H22Cl3N3O |
| Molecular Weight | 354.71 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidoyl chloride;dihydrochloride |
| SMILES | Cl.Cl.ClC(=NOCCCN1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C14H20ClN3O.2ClH/c15-14(13-6-4-7-16-12-13)17-19-11-5-10-18-8-2-1-3-9-18;;/h4,6-7,12H,1-3,5,8-11H2;2*1H |
| InChIKey | HPJXQKQVNBUUPC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|