C14H24Cl2N4O — CID 87475486
N'-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidamide;dihydrochloride (PubChem CID 87475486) has the molecular formula C14H24Cl2N4O and a molecular weight of 335.28 g/mol. Its IUPAC name is N'-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidamide;dihydrochloride.
| Compound Name | N'-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 87475486 |
| Molecular Formula | C14H24Cl2N4O |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N'-(3-piperidin-1-ylpropoxy)pyridine-3-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\OCCCN1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C14H22N4O.2ClH/c15-14(13-6-4-7-16-12-13)17-19-11-5-10-18-8-2-1-3-9-18;;/h4,6-7,12H,1-3,5,8-11H2,(H2,15,17);2*1H |
| InChIKey | RYWOIGRZGFRIPS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|