C33H37Cl2N5O2S — CID 88503010
N-[3-[C-phenyl-N-(3-piperidin-1-ylpropoxy)carbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;dihydrochloride (PubChem CID 88503010) has the molecular formula C33H37Cl2N5O2S and a molecular weight of 638.67 g/mol. Its IUPAC name is N-[3-[C-phenyl-N-(3-piperidin-1-ylpropoxy)carbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;dihydrochloride.
| Compound Name | N-[3-[C-phenyl-N-(3-piperidin-1-ylpropoxy)carbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 88503010 |
| Molecular Formula | C33H37Cl2N5O2S |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | N-[3-[C-phenyl-N-(3-piperidin-1-ylpropoxy)carbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cccc(C(=NOCCCN2CCCCC2)c2ccccc2)c1)c1ccn2c1CSC2c1cccnc1 |
| InChI | InChI=1S/C33H35N5O2S.2ClH/c39-32(29-15-20-38-30(29)24-41-33(38)27-13-8-16-34-23-27)35-28-14-7-12-26(22-28)31(25-10-3-1-4-11-25)36-40-21-9-19-37-17-5-2-6-18-37;;/h1,3-4,7-8,10-16,20,22-23,33H,2,5-6,9,17-19,21,24H2,(H,35,39);2*1H |
| InChIKey | OKFUTFFXIFAEPP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|