C31H31N5O4S — CID 173369453
N-[3-[N-(1-methylpiperidin-4-yl)oxy-C-phenylcarbonimidoyl]phenyl]-2,2-dioxo-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide (PubChem CID 173369453) has the molecular formula C31H31N5O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is N-[3-[N-(1-methylpiperidin-4-yl)oxy-C-phenylcarbonimidoyl]phenyl]-2,2-dioxo-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide.
| Compound Name | N-[3-[N-(1-methylpiperidin-4-yl)oxy-C-phenylcarbonimidoyl]phenyl]-2,2-dioxo-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
|---|---|
| PubChem CID | 173369453 |
| Molecular Formula | C31H31N5O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | N-[3-[N-(1-methylpiperidin-4-yl)oxy-C-phenylcarbonimidoyl]phenyl]-2,2-dioxo-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
| SMILES | CN1CCC(ON=C(c2ccccc2)c2cccc(NC(=O)c3ccn4c3CS(=O)(=O)C4c3cccnc3)c2)CC1 |
| InChI | InChI=1S/C31H31N5O4S/c1-35-16-12-26(13-17-35)40-34-29(22-7-3-2-4-8-22)23-9-5-11-25(19-23)33-30(37)27-14-18-36-28(27)21-41(38,39)31(36)24-10-6-15-32-20-24/h2-11,14-15,18-20,26,31H,12-13,16-17,21H2,1H3,(H,33,37) |
| InChIKey | BZQRGCPJOOHKHA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|