C37H37N5O2S — CID 88503160
N-[3-[N-[3-[benzyl(ethyl)amino]propoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide (PubChem CID 88503160) has the molecular formula C37H37N5O2S and a molecular weight of 615.80 g/mol. Its IUPAC name is N-[3-[N-[3-[benzyl(ethyl)amino]propoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide.
| Compound Name | N-[3-[N-[3-[benzyl(ethyl)amino]propoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
|---|---|
| PubChem CID | 88503160 |
| Molecular Formula | C37H37N5O2S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | N-[3-[N-[3-[benzyl(ethyl)amino]propoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
| SMILES | CCN(CCCON=C(c1ccccc1)c1cccc(NC(=O)c2ccn3c2CSC3c2cccnc2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C37H37N5O2S/c1-2-41(26-28-12-5-3-6-13-28)21-11-23-44-40-35(29-14-7-4-8-15-29)30-16-9-18-32(24-30)39-36(43)33-19-22-42-34(33)27-45-37(42)31-17-10-20-38-25-31/h3-10,12-20,22,24-25,37H,2,11,21,23,26-27H2,1H3,(H,39,43) |
| InChIKey | OLLHCJXOERTRFT-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|