C28H28ClN5O2S — CID 88502763
N-[3-[(E)-N-[2-(methylamino)ethoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;hydrochloride (PubChem CID 88502763) has the molecular formula C28H28ClN5O2S and a molecular weight of 534.09 g/mol. Its IUPAC name is N-[3-[(E)-N-[2-(methylamino)ethoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;hydrochloride.
| Compound Name | N-[3-[(E)-N-[2-(methylamino)ethoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 88502763 |
| Molecular Formula | C28H28ClN5O2S |
| Molecular Weight | 534.09 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | N-[3-[(E)-N-[2-(methylamino)ethoxy]-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide;hydrochloride |
| SMILES | CNCCO/N=C(\c1ccccc1)c1cccc(NC(=O)c2ccn3c2CSC3c2cccnc2)c1.Cl |
| InChI | InChI=1S/C28H27N5O2S.ClH/c1-29-14-16-35-32-26(20-7-3-2-4-8-20)21-9-5-11-23(17-21)31-27(34)24-12-15-33-25(24)19-36-28(33)22-10-6-13-30-18-22;/h2-13,15,17-18,28-29H,14,16,19H2,1H3,(H,31,34);1H/b32-26+; |
| InChIKey | WMLLNESJVQXCNZ-PDOPWPJASA-N |
| XLogP | 5.34 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|