C31H30ClN5O3S — CID 88502768
N-[2-chloro-5-[(E)-N-(2-morpholin-4-ylethoxy)-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide (PubChem CID 88502768) has the molecular formula C31H30ClN5O3S and a molecular weight of 588.13 g/mol. Its IUPAC name is N-[2-chloro-5-[(E)-N-(2-morpholin-4-ylethoxy)-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide.
| Compound Name | N-[2-chloro-5-[(E)-N-(2-morpholin-4-ylethoxy)-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
|---|---|
| PubChem CID | 88502768 |
| Molecular Formula | C31H30ClN5O3S |
| Molecular Weight | 588.13 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | N-[2-chloro-5-[(E)-N-(2-morpholin-4-ylethoxy)-C-phenylcarbonimidoyl]phenyl]-3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazole-7-carboxamide |
| SMILES | O=C(Nc1cc(/C(=N/OCCN2CCOCC2)c2ccccc2)ccc1Cl)c1ccn2c1CSC2c1cccnc1 |
| InChI | InChI=1S/C31H30ClN5O3S/c32-26-9-8-23(29(22-5-2-1-3-6-22)35-40-18-15-36-13-16-39-17-14-36)19-27(26)34-30(38)25-10-12-37-28(25)21-41-31(37)24-7-4-11-33-20-24/h1-12,19-20,31H,13-18,21H2,(H,34,38)/b35-29+ |
| InChIKey | AUENSZYXVHABRF-OZMGXUMRSA-N |
| XLogP | 5.68 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.13 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|