C26H20N6O2S — CID 88525648
phenyl N-cyano-N'-[3-[(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)carbamoyl]phenyl]carbamimidate (PubChem CID 88525648) has the molecular formula C26H20N6O2S and a molecular weight of 480.55 g/mol. Its IUPAC name is phenyl N-cyano-N'-[3-[(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)carbamoyl]phenyl]carbamimidate.
| Compound Name | phenyl N-cyano-N'-[3-[(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)carbamoyl]phenyl]carbamimidate |
|---|---|
| PubChem CID | 88525648 |
| Molecular Formula | C26H20N6O2S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | phenyl N-cyano-N'-[3-[(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)carbamoyl]phenyl]carbamimidate |
| SMILES | N#CN/C(=N\c1cccc(C(=O)Nc2ccn3c2CSC3c2cccnc2)c1)Oc1ccccc1 |
| InChI | InChI=1S/C26H20N6O2S/c27-17-29-26(34-21-9-2-1-3-10-21)30-20-8-4-6-18(14-20)24(33)31-22-11-13-32-23(22)16-35-25(32)19-7-5-12-28-15-19/h1-15,25H,16H2,(H,29,30)(H,31,33) |
| InChIKey | KFOSUYZWABQPBE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|