C22H21N5OS — CID 139615811
N-cyano-3-propan-2-yloxy-N'-(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)benzenecarboximidamide (PubChem CID 139615811) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is N-cyano-3-propan-2-yloxy-N'-(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)benzenecarboximidamide.
| Compound Name | N-cyano-3-propan-2-yloxy-N'-(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 139615811 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-cyano-3-propan-2-yloxy-N'-(3-pyridin-3-yl-1,3-dihydropyrrolo[1,2-c][1,3]thiazol-7-yl)benzenecarboximidamide |
| SMILES | CC(C)Oc1cccc(/C(=N/c2ccn3c2CSC3c2cccnc2)NC#N)c1 |
| InChI | InChI=1S/C22H21N5OS/c1-15(2)28-18-7-3-5-16(11-18)21(25-14-23)26-19-8-10-27-20(19)13-29-22(27)17-6-4-9-24-12-17/h3-12,15,22H,13H2,1-2H3,(H,25,26) |
| InChIKey | GUWDUXNMFJKBCE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|